About 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate
5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate (PubChem CID 154217829) has the molecular formula C14H18ClNO2S
and a molecular weight of 299.82 g/mol. Its IUPAC name is 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate.
Molecular Properties
| Compound Name | 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate |
| PubChem CID | 154217829 |
| Molecular Formula | C14H18ClNO2S |
| Molecular Weight | 299.82 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate |
| SMILES | C=CSCCCCCOC(=O)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H18ClNO2S/c1-2-19-11-5-3-4-10-18-14(17)16-13-8-6-12(15)7-9-13/h2,6-9H,1,3-5,10-11H2,(H,16,17) |
| InChIKey | DXQSFOYNZJIONE-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.82 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate?
The IUPAC name of 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate (CID 154217829) is 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate.
What is the SMILES notation for 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate?
The canonical SMILES for 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate is C=CSCCCCCOC(=O)Nc1ccc(Cl)cc1.
What is the InChIKey of 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate?
The InChIKey is DXQSFOYNZJIONE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18ClNO2S/c1-2-19-11-5-3-4-10-18-14(17)16-13-8-6-12(15)7-9-13/h2,6-9H,1,3-5,10-11H2,(H,16,17).
What are the key properties of 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate?
5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate has a molecular weight of 299.82 g/mol, XLogP of 4.94, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethenylsulfanylpentyl N-(4-chlorophenyl)carbamate is sourced from PubChem (CID 154217829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).