C13H21N7 — CID 13499378
1,2-bis[3-(1H-imidazol-5-yl)propyl]guanidine (PubChem CID 13499378) has the molecular formula C13H21N7 and a molecular weight of 275.36 g/mol. Its IUPAC name is 1,2-bis[3-(1H-imidazol-5-yl)propyl]guanidine.
| Compound Name | 1,2-bis[3-(1H-imidazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 13499378 |
| Molecular Formula | C13H21N7 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1,2-bis[3-(1H-imidazol-5-yl)propyl]guanidine |
| SMILES | N/C(=N\CCCc1cnc[nH]1)NCCCc1cnc[nH]1 |
| InChI | InChI=1S/C13H21N7/c14-13(17-5-1-3-11-7-15-9-19-11)18-6-2-4-12-8-16-10-20-12/h7-10H,1-6H2,(H,15,19)(H,16,20)(H3,14,17,18) |
| InChIKey | MELDRNNXBBRNLZ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|