C22H25F2N5 — CID 15014658
1-[3,3-bis(3-fluorophenyl)propyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine (PubChem CID 15014658) has the molecular formula C22H25F2N5 and a molecular weight of 397.47 g/mol. Its IUPAC name is 1-[3,3-bis(3-fluorophenyl)propyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine.
| Compound Name | 1-[3,3-bis(3-fluorophenyl)propyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine |
|---|---|
| PubChem CID | 15014658 |
| Molecular Formula | C22H25F2N5 |
| Molecular Weight | 397.47 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | 1-[3,3-bis(3-fluorophenyl)propyl]-2-[3-(1H-imidazol-5-yl)propyl]guanidine |
| SMILES | N/C(=N\CCCc1cnc[nH]1)NCCC(c1cccc(F)c1)c1cccc(F)c1 |
| InChI | InChI=1S/C22H25F2N5/c23-18-6-1-4-16(12-18)21(17-5-2-7-19(24)13-17)9-11-28-22(25)27-10-3-8-20-14-26-15-29-20/h1-2,4-7,12-15,21H,3,8-11H2,(H,26,29)(H3,25,27,28) |
| InChIKey | JTGBMYIABMPZQP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.47 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|