C22H26N4S — CID 45268095
3-(1H-imidazol-5-yl)propyl N'-(3,3-diphenylpropyl)carbamimidothioate (PubChem CID 45268095) has the molecular formula C22H26N4S and a molecular weight of 378.55 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N'-(3,3-diphenylpropyl)carbamimidothioate.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N'-(3,3-diphenylpropyl)carbamimidothioate |
|---|---|
| PubChem CID | 45268095 |
| Molecular Formula | C22H26N4S |
| Molecular Weight | 378.55 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N'-(3,3-diphenylpropyl)carbamimidothioate |
| SMILES | N/C(=N/CCC(c1ccccc1)c1ccccc1)SCCCc1cnc[nH]1 |
| InChI | InChI=1S/C22H26N4S/c23-22(27-15-7-12-20-16-24-17-26-20)25-14-13-21(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,16-17,21H,7,12-15H2,(H2,23,25)(H,24,26) |
| InChIKey | WWTASRSHEGBDMT-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.55 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|