C21H24Br2Cl2N4S — CID 56851605
3-(1H-imidazol-5-yl)propyl N-benzyl-N'-[(3,4-dichlorophenyl)methyl]carbamimidothioate;dihydrobromide (PubChem CID 56851605) has the molecular formula C21H24Br2Cl2N4S and a molecular weight of 595.23 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-benzyl-N'-[(3,4-dichlorophenyl)methyl]carbamimidothioate;dihydrobromide.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-benzyl-N'-[(3,4-dichlorophenyl)methyl]carbamimidothioate;dihydrobromide |
|---|---|
| PubChem CID | 56851605 |
| Molecular Formula | C21H24Br2Cl2N4S |
| Molecular Weight | 595.23 g/mol |
| Exact Mass | 591.95 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-benzyl-N'-[(3,4-dichlorophenyl)methyl]carbamimidothioate;dihydrobromide |
| SMILES | Br.Br.Clc1ccc(C/N=C(/NCc2ccccc2)SCCCc2cnc[nH]2)cc1Cl |
| InChI | InChI=1S/C21H22Cl2N4S.2BrH/c22-19-9-8-17(11-20(19)23)13-26-21(25-12-16-5-2-1-3-6-16)28-10-4-7-18-14-24-15-27-18;;/h1-3,5-6,8-9,11,14-15H,4,7,10,12-13H2,(H,24,27)(H,25,26);2*1H |
| InChIKey | UKFQLUAZQNLWRG-UHFFFAOYSA-N |
| XLogP | 6.88 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.23 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|