C16H29BrN4S — CID 57397909
3-(1H-imidazol-5-yl)propyl N-tert-butyl-N'-cyclopentylcarbamimidothioate;hydrobromide (PubChem CID 57397909) has the molecular formula C16H29BrN4S and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N-tert-butyl-N'-cyclopentylcarbamimidothioate;hydrobromide.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N-tert-butyl-N'-cyclopentylcarbamimidothioate;hydrobromide |
|---|---|
| PubChem CID | 57397909 |
| Molecular Formula | C16H29BrN4S |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N-tert-butyl-N'-cyclopentylcarbamimidothioate;hydrobromide |
| SMILES | Br.CC(C)(C)N/C(=N\C1CCCC1)SCCCc1cnc[nH]1 |
| InChI | InChI=1S/C16H28N4S.BrH/c1-16(2,3)20-15(19-13-7-4-5-8-13)21-10-6-9-14-11-17-12-18-14;/h11-13H,4-10H2,1-3H3,(H,17,18)(H,19,20);1H |
| InChIKey | ZSMDSVQCIUEXOD-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|