C15H20N4S — CID 10085528
3-(1H-imidazol-5-yl)propyl N'-(2-phenylethyl)carbamimidothioate (PubChem CID 10085528) has the molecular formula C15H20N4S and a molecular weight of 288.42 g/mol. Its IUPAC name is 3-(1H-imidazol-5-yl)propyl N'-(2-phenylethyl)carbamimidothioate.
| Compound Name | 3-(1H-imidazol-5-yl)propyl N'-(2-phenylethyl)carbamimidothioate |
|---|---|
| PubChem CID | 10085528 |
| Molecular Formula | C15H20N4S |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 3-(1H-imidazol-5-yl)propyl N'-(2-phenylethyl)carbamimidothioate |
| SMILES | N/C(=N/CCc1ccccc1)SCCCc1cnc[nH]1 |
| InChI | InChI=1S/C15H20N4S/c16-15(18-9-8-13-5-2-1-3-6-13)20-10-4-7-14-11-17-12-19-14/h1-3,5-6,11-12H,4,7-10H2,(H2,16,18)(H,17,19) |
| InChIKey | KLOWQCMHDZVUBY-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|