C25H25N5 — CID 91512391
2-[2-(1H-imidazol-5-yl)ethyl]-1-tritylguanidine (PubChem CID 91512391) has the molecular formula C25H25N5 and a molecular weight of 395.51 g/mol. Its IUPAC name is 2-[2-(1H-imidazol-5-yl)ethyl]-1-tritylguanidine.
| Compound Name | 2-[2-(1H-imidazol-5-yl)ethyl]-1-tritylguanidine |
|---|---|
| PubChem CID | 91512391 |
| Molecular Formula | C25H25N5 |
| Molecular Weight | 395.51 g/mol |
| Exact Mass | 395.21 |
| IUPAC Name | 2-[2-(1H-imidazol-5-yl)ethyl]-1-tritylguanidine |
| SMILES | N/C(=N\CCc1cnc[nH]1)NC(c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C25H25N5/c26-24(28-17-16-23-18-27-19-29-23)30-25(20-10-4-1-5-11-20,21-12-6-2-7-13-21)22-14-8-3-9-15-22/h1-15,18-19H,16-17H2,(H,27,29)(H3,26,28,30) |
| InChIKey | NXYAJGMUGISBFM-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.51 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|