C8H16N6 — CID 104886521
1-amino-3-ethyl-2-[2-(1H-imidazol-5-yl)ethyl]guanidine (PubChem CID 104886521) has the molecular formula C8H16N6 and a molecular weight of 196.26 g/mol. Its IUPAC name is 1-amino-3-ethyl-2-[2-(1H-imidazol-5-yl)ethyl]guanidine.
| Compound Name | 1-amino-3-ethyl-2-[2-(1H-imidazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 104886521 |
| Molecular Formula | C8H16N6 |
| Molecular Weight | 196.26 g/mol |
| Exact Mass | 196.14 |
| IUPAC Name | 1-amino-3-ethyl-2-[2-(1H-imidazol-5-yl)ethyl]guanidine |
| SMILES | CCN/C(=N\CCc1cnc[nH]1)NN |
| InChI | InChI=1S/C8H16N6/c1-2-11-8(14-9)12-4-3-7-5-10-6-13-7/h5-6H,2-4,9H2,1H3,(H,10,13)(H2,11,12,14) |
| InChIKey | IWXOSDNDANEFGB-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 91.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.26 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|