C10H20N6O — CID 104887166
1-amino-3-(3-ethoxypropyl)-2-(1H-imidazol-5-ylmethyl)guanidine (PubChem CID 104887166) has the molecular formula C10H20N6O and a molecular weight of 240.31 g/mol. Its IUPAC name is 1-amino-3-(3-ethoxypropyl)-2-(1H-imidazol-5-ylmethyl)guanidine.
| Compound Name | 1-amino-3-(3-ethoxypropyl)-2-(1H-imidazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 104887166 |
| Molecular Formula | C10H20N6O |
| Molecular Weight | 240.31 g/mol |
| Exact Mass | 240.17 |
| IUPAC Name | 1-amino-3-(3-ethoxypropyl)-2-(1H-imidazol-5-ylmethyl)guanidine |
| SMILES | CCOCCCN/C(=N\Cc1cnc[nH]1)NN |
| InChI | InChI=1S/C10H20N6O/c1-2-17-5-3-4-13-10(16-11)14-7-9-6-12-8-15-9/h6,8H,2-5,7,11H2,1H3,(H,12,15)(H2,13,14,16) |
| InChIKey | LXMIEWXYAWMWMI-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 100.35 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.31 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|