C16H22N4S — CID 67642818
3-(1H-imidazol-2-yl)propyl N'-(3-phenylpropyl)carbamimidothioate (PubChem CID 67642818) has the molecular formula C16H22N4S and a molecular weight of 302.45 g/mol. Its IUPAC name is 3-(1H-imidazol-2-yl)propyl N'-(3-phenylpropyl)carbamimidothioate.
| Compound Name | 3-(1H-imidazol-2-yl)propyl N'-(3-phenylpropyl)carbamimidothioate |
|---|---|
| PubChem CID | 67642818 |
| Molecular Formula | C16H22N4S |
| Molecular Weight | 302.45 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | 3-(1H-imidazol-2-yl)propyl N'-(3-phenylpropyl)carbamimidothioate |
| SMILES | N/C(=N/CCCc1ccccc1)SCCCc1ncc[nH]1 |
| InChI | InChI=1S/C16H22N4S/c17-16(21-13-5-9-15-18-11-12-19-15)20-10-4-8-14-6-2-1-3-7-14/h1-3,6-7,11-12H,4-5,8-10,13H2,(H2,17,20)(H,18,19) |
| InChIKey | CUVIFVSWPBEDRN-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 67.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.45 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|