C14H18IN5 — CID 10045474
1-[3-(1H-imidazol-5-yl)propyl]-2-[(4-iodophenyl)methyl]guanidine (PubChem CID 10045474) has the molecular formula C14H18IN5 and a molecular weight of 383.24 g/mol. Its IUPAC name is 1-[3-(1H-imidazol-5-yl)propyl]-2-[(4-iodophenyl)methyl]guanidine.
| Compound Name | 1-[3-(1H-imidazol-5-yl)propyl]-2-[(4-iodophenyl)methyl]guanidine |
|---|---|
| PubChem CID | 10045474 |
| Molecular Formula | C14H18IN5 |
| Molecular Weight | 383.24 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | 1-[3-(1H-imidazol-5-yl)propyl]-2-[(4-iodophenyl)methyl]guanidine |
| SMILES | N/C(=N\Cc1ccc(I)cc1)NCCCc1cnc[nH]1 |
| InChI | InChI=1S/C14H18IN5/c15-12-5-3-11(4-6-12)8-19-14(16)18-7-1-2-13-9-17-10-20-13/h3-6,9-10H,1-2,7-8H2,(H,17,20)(H3,16,18,19) |
| InChIKey | ZDWBAVJCYLOFNL-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 79.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.24 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|