C20H25BrN8 — CID 54247865
2-[3-[(4-bromophenyl)methyl-pyrimidin-2-ylamino]propyl]-1-[2-(1H-imidazol-5-yl)ethyl]guanidine (PubChem CID 54247865) has the molecular formula C20H25BrN8 and a molecular weight of 457.38 g/mol. Its IUPAC name is 2-[3-[(4-bromophenyl)methyl-pyrimidin-2-ylamino]propyl]-1-[2-(1H-imidazol-5-yl)ethyl]guanidine.
| Compound Name | 2-[3-[(4-bromophenyl)methyl-pyrimidin-2-ylamino]propyl]-1-[2-(1H-imidazol-5-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 54247865 |
| Molecular Formula | C20H25BrN8 |
| Molecular Weight | 457.38 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | 2-[3-[(4-bromophenyl)methyl-pyrimidin-2-ylamino]propyl]-1-[2-(1H-imidazol-5-yl)ethyl]guanidine |
| SMILES | N/C(=N\CCCN(Cc1ccc(Br)cc1)c1ncccn1)NCCc1cnc[nH]1 |
| InChI | InChI=1S/C20H25BrN8/c21-17-5-3-16(4-6-17)14-29(20-26-8-1-9-27-20)12-2-10-24-19(22)25-11-7-18-13-23-15-28-18/h1,3-6,8-9,13,15H,2,7,10-12,14H2,(H,23,28)(H3,22,24,25) |
| InChIKey | QUORDSJPDDISQK-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 108.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.38 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|