C17H27N7 — CID 57078596
2-[3-(1H-imidazol-5-yl)propyl]-1-[3-[(5-methyl-2-pyridinyl)methylamino]propyl]guanidine (PubChem CID 57078596) has the molecular formula C17H27N7 and a molecular weight of 329.45 g/mol. Its IUPAC name is 2-[3-(1H-imidazol-5-yl)propyl]-1-[3-[(5-methyl-2-pyridinyl)methylamino]propyl]guanidine.
| Compound Name | 2-[3-(1H-imidazol-5-yl)propyl]-1-[3-[(5-methyl-2-pyridinyl)methylamino]propyl]guanidine |
|---|---|
| PubChem CID | 57078596 |
| Molecular Formula | C17H27N7 |
| Molecular Weight | 329.45 g/mol |
| Exact Mass | 329.23 |
| IUPAC Name | 2-[3-(1H-imidazol-5-yl)propyl]-1-[3-[(5-methyl-2-pyridinyl)methylamino]propyl]guanidine |
| SMILES | Cc1ccc(CNCCCN/C(N)=N/CCCc2cnc[nH]2)nc1 |
| InChI | InChI=1S/C17H27N7/c1-14-5-6-16(23-10-14)11-19-7-3-9-22-17(18)21-8-2-4-15-12-20-13-24-15/h5-6,10,12-13,19H,2-4,7-9,11H2,1H3,(H,20,24)(H3,18,21,22) |
| InChIKey | GGJHXLAWGVRATH-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.45 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|