C16H25N7 — CID 151722745
1-[2-(1H-imidazol-5-yl)ethyl]-2-[3-[methyl-(5-methyl-2-pyridinyl)amino]propyl]guanidine (PubChem CID 151722745) has the molecular formula C16H25N7 and a molecular weight of 315.43 g/mol. Its IUPAC name is 1-[2-(1H-imidazol-5-yl)ethyl]-2-[3-[methyl-(5-methyl-2-pyridinyl)amino]propyl]guanidine.
| Compound Name | 1-[2-(1H-imidazol-5-yl)ethyl]-2-[3-[methyl-(5-methyl-2-pyridinyl)amino]propyl]guanidine |
|---|---|
| PubChem CID | 151722745 |
| Molecular Formula | C16H25N7 |
| Molecular Weight | 315.43 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 1-[2-(1H-imidazol-5-yl)ethyl]-2-[3-[methyl-(5-methyl-2-pyridinyl)amino]propyl]guanidine |
| SMILES | Cc1ccc(N(C)CCC/N=C(\N)NCCc2cnc[nH]2)nc1 |
| InChI | InChI=1S/C16H25N7/c1-13-4-5-15(21-10-13)23(2)9-3-7-19-16(17)20-8-6-14-11-18-12-22-14/h4-5,10-12H,3,6-9H2,1-2H3,(H,18,22)(H3,17,19,20) |
| InChIKey | RIXRZWLRGRIYBZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 95.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.43 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|