C30H38N4O2S — CID 152769384
5-[6-[6-(1H-imidazol-5-yl)-2-phenylhexyl]sulfonyl-5-phenylhexyl]-1H-imidazole (PubChem CID 152769384) has the molecular formula C30H38N4O2S and a molecular weight of 518.73 g/mol. Its IUPAC name is 5-[6-[6-(1H-imidazol-5-yl)-2-phenylhexyl]sulfonyl-5-phenylhexyl]-1H-imidazole.
| Compound Name | 5-[6-[6-(1H-imidazol-5-yl)-2-phenylhexyl]sulfonyl-5-phenylhexyl]-1H-imidazole |
|---|---|
| PubChem CID | 152769384 |
| Molecular Formula | C30H38N4O2S |
| Molecular Weight | 518.73 g/mol |
| Exact Mass | 518.27 |
| IUPAC Name | 5-[6-[6-(1H-imidazol-5-yl)-2-phenylhexyl]sulfonyl-5-phenylhexyl]-1H-imidazole |
| SMILES | O=S(=O)(CC(CCCCc1cnc[nH]1)c1ccccc1)CC(CCCCc1cnc[nH]1)c1ccccc1 |
| InChI | InChI=1S/C30H38N4O2S/c35-37(36,21-27(25-11-3-1-4-12-25)15-7-9-17-29-19-31-23-33-29)22-28(26-13-5-2-6-14-26)16-8-10-18-30-20-32-24-34-30/h1-6,11-14,19-20,23-24,27-28H,7-10,15-18,21-22H2,(H,31,33)(H,32,34) |
| InChIKey | SSIBTWPKRGIYIE-UHFFFAOYSA-N |
| XLogP | 6.24 |
| TPSA | 91.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.73 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|