C21H24N2 — CID 10780854
5-[4,4-bis(4-methylphenyl)butyl]-1H-imidazole (PubChem CID 10780854) has the molecular formula C21H24N2 and a molecular weight of 304.44 g/mol. Its IUPAC name is 5-[4,4-bis(4-methylphenyl)butyl]-1H-imidazole.
| Compound Name | 5-[4,4-bis(4-methylphenyl)butyl]-1H-imidazole |
|---|---|
| PubChem CID | 10780854 |
| Molecular Formula | C21H24N2 |
| Molecular Weight | 304.44 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 5-[4,4-bis(4-methylphenyl)butyl]-1H-imidazole |
| SMILES | Cc1ccc(C(CCCc2cnc[nH]2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H24N2/c1-16-6-10-18(11-7-16)21(19-12-8-17(2)9-13-19)5-3-4-20-14-22-15-23-20/h6-15,21H,3-5H2,1-2H3,(H,22,23) |
| InChIKey | QPIUAAWRHUZOTB-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.44 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |