C13H24N2O2 — CID 150316207
10-(1H-imidazol-5-yl)decane-1,1-diol (PubChem CID 150316207) has the molecular formula C13H24N2O2 and a molecular weight of 240.35 g/mol. Its IUPAC name is 10-(1H-imidazol-5-yl)decane-1,1-diol.
| Compound Name | 10-(1H-imidazol-5-yl)decane-1,1-diol |
|---|---|
| PubChem CID | 150316207 |
| Molecular Formula | C13H24N2O2 |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.18 |
| IUPAC Name | 10-(1H-imidazol-5-yl)decane-1,1-diol |
| SMILES | OC(O)CCCCCCCCCc1cnc[nH]1 |
| InChI | InChI=1S/C13H24N2O2/c16-13(17)9-7-5-3-1-2-4-6-8-12-10-14-11-15-12/h10-11,13,16-17H,1-9H2,(H,14,15) |
| InChIKey | GMQWDLXHKPIEKF-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 69.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|