2-(1H-imidazol-5-yl)ethanol;molecular hydrogen

C5H10N2O — CID 168881125

IUPAC2-(1H-imidazol-5-yl)ethanol;molecular hydrogen
SMILESOCCc1cnc[nH]1.[H][H]
InChIInChI=1S/C5H8N2O.H2/c8-2-1-5-3-6-4-7-5;/h3-4,8H,1-2H2,(H,6,7);1H
InChIKeyYEOXISPQTFPIIX-UHFFFAOYSA-N
MW114.15 g/mol
LogP0.19
Rot. Bonds2

About 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen

2-(1H-imidazol-5-yl)ethanol;molecular hydrogen (PubChem CID 168881125) has the molecular formula C5H10N2O and a molecular weight of 114.15 g/mol. Its IUPAC name is 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen.

Molecular Properties

Compound Name2-(1H-imidazol-5-yl)ethanol;molecular hydrogen
PubChem CID168881125
Molecular FormulaC5H10N2O
Molecular Weight114.15 g/mol
Exact Mass114.08
IUPAC Name2-(1H-imidazol-5-yl)ethanol;molecular hydrogen
SMILESOCCc1cnc[nH]1.[H][H]
InChIInChI=1S/C5H8N2O.H2/c8-2-1-5-3-6-4-7-5;/h3-4,8H,1-2H2,(H,6,7);1H
InChIKeyYEOXISPQTFPIIX-UHFFFAOYSA-N
XLogP0.19
TPSA48.91 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500114.15
LogP ≤ 50.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen?
The IUPAC name of 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen (CID 168881125) is 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen.
What is the SMILES notation for 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen?
The canonical SMILES for 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen is OCCc1cnc[nH]1.[H][H].
What is the InChIKey of 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen?
The InChIKey is YEOXISPQTFPIIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O.H2/c8-2-1-5-3-6-4-7-5;/h3-4,8H,1-2H2,(H,6,7);1H.
What are the key properties of 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen?
2-(1H-imidazol-5-yl)ethanol;molecular hydrogen has a molecular weight of 114.15 g/mol, XLogP of 0.19, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1H-imidazol-5-yl)ethanol;molecular hydrogen is sourced from PubChem (CID 168881125), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).