C8H12N2O3 — CID 91011119
1,2-dihydroxy-5-(1H-imidazol-5-yl)pentan-3-one (PubChem CID 91011119) has the molecular formula C8H12N2O3 and a molecular weight of 184.19 g/mol. Its IUPAC name is 1,2-dihydroxy-5-(1H-imidazol-5-yl)pentan-3-one.
| Compound Name | 1,2-dihydroxy-5-(1H-imidazol-5-yl)pentan-3-one |
|---|---|
| PubChem CID | 91011119 |
| Molecular Formula | C8H12N2O3 |
| Molecular Weight | 184.19 g/mol |
| Exact Mass | 184.08 |
| IUPAC Name | 1,2-dihydroxy-5-(1H-imidazol-5-yl)pentan-3-one |
| SMILES | O=C(CCc1cnc[nH]1)C(O)CO |
| InChI | InChI=1S/C8H12N2O3/c11-4-8(13)7(12)2-1-6-3-9-5-10-6/h3,5,8,11,13H,1-2,4H2,(H,9,10) |
| InChIKey | XHSPRHAEENZSLT-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 86.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.19 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |