C26H36N4O2S — CID 163605135
N-[(2,5-dimethylphenyl)methyl]-N-(dimethylsulfamoyl)-6-(1H-imidazol-5-yl)-1-phenylhexan-2-amine (PubChem CID 163605135) has the molecular formula C26H36N4O2S and a molecular weight of 468.67 g/mol. Its IUPAC name is N-[(2,5-dimethylphenyl)methyl]-N-(dimethylsulfamoyl)-6-(1H-imidazol-5-yl)-1-phenylhexan-2-amine.
| Compound Name | N-[(2,5-dimethylphenyl)methyl]-N-(dimethylsulfamoyl)-6-(1H-imidazol-5-yl)-1-phenylhexan-2-amine |
|---|---|
| PubChem CID | 163605135 |
| Molecular Formula | C26H36N4O2S |
| Molecular Weight | 468.67 g/mol |
| Exact Mass | 468.26 |
| IUPAC Name | N-[(2,5-dimethylphenyl)methyl]-N-(dimethylsulfamoyl)-6-(1H-imidazol-5-yl)-1-phenylhexan-2-amine |
| SMILES | Cc1ccc(C)c(CN(C(CCCCc2cnc[nH]2)Cc2ccccc2)S(=O)(=O)N(C)C)c1 |
| InChI | InChI=1S/C26H36N4O2S/c1-21-14-15-22(2)24(16-21)19-30(33(31,32)29(3)4)26(17-23-10-6-5-7-11-23)13-9-8-12-25-18-27-20-28-25/h5-7,10-11,14-16,18,20,26H,8-9,12-13,17,19H2,1-4H3,(H,27,28) |
| InChIKey | HBCFADFPDFKVLJ-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 69.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.67 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|