C30H41N5O5S — CID 91237928
(2S)-2-[[(2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoyl]-(4-methylphenyl)sulfonylamino]-6-(2-methylpropylamino)hexanoic acid (PubChem CID 91237928) has the molecular formula C30H41N5O5S and a molecular weight of 583.76 g/mol. Its IUPAC name is (2S)-2-[[(2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoyl]-(4-methylphenyl)sulfonylamino]-6-(2-methylpropylamino)hexanoic acid.
| Compound Name | (2S)-2-[[(2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoyl]-(4-methylphenyl)sulfonylamino]-6-(2-methylpropylamino)hexanoic acid |
|---|---|
| PubChem CID | 91237928 |
| Molecular Formula | C30H41N5O5S |
| Molecular Weight | 583.76 g/mol |
| Exact Mass | 583.28 |
| IUPAC Name | (2S)-2-[[(2S)-2-(benzylamino)-3-(1H-imidazol-5-yl)propanoyl]-(4-methylphenyl)sulfonylamino]-6-(2-methylpropylamino)hexanoic acid |
| SMILES | Cc1ccc(S(=O)(=O)N(C(=O)[C@H](Cc2cnc[nH]2)NCc2ccccc2)[C@@H](CCCCNCC(C)C)C(=O)O)cc1 |
| InChI | InChI=1S/C30H41N5O5S/c1-22(2)18-31-16-8-7-11-28(30(37)38)35(41(39,40)26-14-12-23(3)13-15-26)29(36)27(17-25-20-32-21-34-25)33-19-24-9-5-4-6-10-24/h4-6,9-10,12-15,20-22,27-28,31,33H,7-8,11,16-19H2,1-3H3,(H,32,34)(H,37,38)/t27-,28-/m0/s1 |
| InChIKey | FCDJXXYIWKZOTG-NSOVKSMOSA-N |
| XLogP | 3.51 |
| TPSA | 144.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.76 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|