C28H41N3O7S2 — CID 508537
(2S)-6-[[(2S)-2-(benzenesulfonamido)pentanoyl]amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid (PubChem CID 508537) has the molecular formula C28H41N3O7S2 and a molecular weight of 595.78 g/mol. Its IUPAC name is (2S)-6-[[(2S)-2-(benzenesulfonamido)pentanoyl]amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid.
| Compound Name | (2S)-6-[[(2S)-2-(benzenesulfonamido)pentanoyl]amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 508537 |
| Molecular Formula | C28H41N3O7S2 |
| Molecular Weight | 595.78 g/mol |
| Exact Mass | 595.24 |
| IUPAC Name | (2S)-6-[[(2S)-2-(benzenesulfonamido)pentanoyl]amino]-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoic acid |
| SMILES | CCC[C@H](NS(=O)(=O)c1ccccc1)C(=O)NCCCC[C@@H](C(=O)O)N(CC(C)C)S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H41N3O7S2/c1-5-11-25(30-39(35,36)23-12-7-6-8-13-23)27(32)29-19-10-9-14-26(28(33)34)31(20-21(2)3)40(37,38)24-17-15-22(4)16-18-24/h6-8,12-13,15-18,21,25-26,30H,5,9-11,14,19-20H2,1-4H3,(H,29,32)(H,33,34)/t25-,26-/m0/s1 |
| InChIKey | SMOUYDCFVQNWCU-UIOOFZCWSA-N |
| XLogP | 3.53 |
| TPSA | 149.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.78 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|