C25H33CsN2O6S — CID 23664201
cesium (2S)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]-6-[(2-phenoxyacetyl)amino]hexanoate (PubChem CID 23664201) has the molecular formula C25H33CsN2O6S and a molecular weight of 622.52 g/mol. Its IUPAC name is cesium (2S)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]-6-[(2-phenoxyacetyl)amino]hexanoate.
| Compound Name | cesium (2S)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]-6-[(2-phenoxyacetyl)amino]hexanoate |
|---|---|
| PubChem CID | 23664201 |
| Molecular Formula | C25H33CsN2O6S |
| Molecular Weight | 622.52 g/mol |
| Exact Mass | 622.11 |
| IUPAC Name | cesium (2S)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]-6-[(2-phenoxyacetyl)amino]hexanoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(C)C)[C@@H](CCCCNC(=O)COc2ccccc2)C(=O)[O-])cc1.[Cs+] |
| InChI | InChI=1S/C25H34N2O6S.Cs/c1-19(2)17-27(34(31,32)22-14-12-20(3)13-15-22)23(25(29)30)11-7-8-16-26-24(28)18-33-21-9-5-4-6-10-21;/h4-6,9-10,12-15,19,23H,7-8,11,16-18H2,1-3H3,(H,26,28)(H,29,30);/q;+1/p-1/t23-;/m0./s1 |
| InChIKey | KVTSWHAVVXCOSC-BQAIUKQQSA-M |
| XLogP | -0.87 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.52 |
| LogP ≤ 5 | -0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|