C32H37N2NaO6S — CID 23680333
sodium (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoate (PubChem CID 23680333) has the molecular formula C32H37N2NaO6S and a molecular weight of 600.71 g/mol. Its IUPAC name is sodium (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoate.
| Compound Name | sodium (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoate |
|---|---|
| PubChem CID | 23680333 |
| Molecular Formula | C32H37N2NaO6S |
| Molecular Weight | 600.71 g/mol |
| Exact Mass | 600.23 |
| IUPAC Name | sodium (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[(4-methylphenyl)sulfonyl-(2-methylpropyl)amino]hexanoate |
| SMILES | Cc1ccc(S(=O)(=O)N(CC(C)C)[C@@H](CCCCNC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)[O-])cc1.[Na+] |
| InChI | InChI=1S/C32H38N2O6S.Na/c1-22(2)20-34(41(38,39)24-17-15-23(3)16-18-24)30(31(35)36)14-8-9-19-33-32(37)40-21-29-27-12-6-4-10-25(27)26-11-5-7-13-28(26)29;/h4-7,10-13,15-18,22,29-30H,8-9,14,19-21H2,1-3H3,(H,33,37)(H,35,36);/q;+1/p-1/t30-;/m0./s1 |
| InChIKey | GCYDQFQZUGHURZ-CZCBIWLKSA-M |
| XLogP | 1.47 |
| TPSA | 115.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.71 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|