C24H25NO5S — CID 45146846
[1-(9H-fluoren-9-ylmethoxy)-1-oxopropan-2-yl]azanium;4-methylbenzenesulfonate (PubChem CID 45146846) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is [1-(9H-fluoren-9-ylmethoxy)-1-oxopropan-2-yl]azanium;4-methylbenzenesulfonate.
| Compound Name | [1-(9H-fluoren-9-ylmethoxy)-1-oxopropan-2-yl]azanium;4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 45146846 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [1-(9H-fluoren-9-ylmethoxy)-1-oxopropan-2-yl]azanium;4-methylbenzenesulfonate |
| SMILES | CC([NH3+])C(=O)OCC1c2ccccc2-c2ccccc21.Cc1ccc(S(=O)(=O)[O-])cc1 |
| InChI | InChI=1S/C17H17NO2.C7H8O3S/c1-11(18)17(19)20-10-16-14-8-4-2-6-12(14)13-7-3-5-9-15(13)16;1-6-2-4-7(5-3-6)11(8,9)10/h2-9,11,16H,10,18H2,1H3;2-5H,1H3,(H,8,9,10) |
| InChIKey | AIJGKGHISCUALI-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 111.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|