About 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate
9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate (PubChem CID 98105588) has the molecular formula C17H16ClNO4S
and a molecular weight of 365.84 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate.
Molecular Properties
| Compound Name | 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate |
| PubChem CID | 98105588 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate |
| SMILES | N[C@@H](CS(=O)(=O)Cl)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C17H16ClNO4S/c18-24(21,22)10-16(19)17(20)23-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10,19H2/t16-/m0/s1 |
| InChIKey | MKIMMLAKRPUKFX-INIZCTEOSA-N |
| XLogP | 2.24 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate?
The IUPAC name of 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate (CID 98105588) is 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate.
What is the SMILES notation for 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate?
The canonical SMILES for 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate is N[C@@H](CS(=O)(=O)Cl)C(=O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate?
The InChIKey is MKIMMLAKRPUKFX-INIZCTEOSA-N. The full InChI is InChI=1S/C17H16ClNO4S/c18-24(21,22)10-16(19)17(20)23-9-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10,19H2/t16-/m0/s1.
What are the key properties of 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate?
9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate has a molecular weight of 365.84 g/mol, XLogP of 2.24, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 9H-fluoren-9-ylmethyl (2R)-2-amino-3-chlorosulfonylpropanoate is sourced from PubChem (CID 98105588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).