C19H21NO2 — CID 4038449
9H-fluoren-9-ylmethyl 2-amino-3-methylbutanoate (PubChem CID 4038449) has the molecular formula C19H21NO2 and a molecular weight of 295.38 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl 2-amino-3-methylbutanoate.
| Compound Name | 9H-fluoren-9-ylmethyl 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 4038449 |
| Molecular Formula | C19H21NO2 |
| Molecular Weight | 295.38 g/mol |
| Exact Mass | 295.16 |
| IUPAC Name | 9H-fluoren-9-ylmethyl 2-amino-3-methylbutanoate |
| SMILES | CC(C)C(N)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C19H21NO2/c1-12(2)18(20)19(21)22-11-17-15-9-5-3-7-13(15)14-8-4-6-10-16(14)17/h3-10,12,17-18H,11,20H2,1-2H3 |
| InChIKey | DRDZLWHKMAXEAT-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.38 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |