About bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate
bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate (PubChem CID 11511488) has the molecular formula C32H27NO4
and a molecular weight of 489.57 g/mol. Its IUPAC name is bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate.
Molecular Properties
| Compound Name | bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate |
| PubChem CID | 11511488 |
| Molecular Formula | C32H27NO4 |
| Molecular Weight | 489.57 g/mol |
| Exact Mass | 489.19 |
| IUPAC Name | bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate |
| SMILES | N[C@@H](CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C32H27NO4/c33-30(32(35)37-19-29-26-15-7-3-11-22(26)23-12-4-8-16-27(23)29)17-31(34)36-18-28-24-13-5-1-9-20(24)21-10-2-6-14-25(21)28/h1-16,28-30H,17-19,33H2/t30-/m0/s1 |
| InChIKey | TUZFXEDFDAVZRF-PMERELPUSA-N |
| XLogP | 5.42 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 489.57 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate?
The IUPAC name of bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate (CID 11511488) is bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate.
What is the SMILES notation for bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate?
The canonical SMILES for bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate is N[C@@H](CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OCC1c2ccccc2-c2ccccc21.
What is the InChIKey of bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate?
The InChIKey is TUZFXEDFDAVZRF-PMERELPUSA-N. The full InChI is InChI=1S/C32H27NO4/c33-30(32(35)37-19-29-26-15-7-3-11-22(26)23-12-4-8-16-27(23)29)17-31(34)36-18-28-24-13-5-1-9-20(24)21-10-2-6-14-25(21)28/h1-16,28-30H,17-19,33H2/t30-/m0/s1.
What are the key properties of bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate?
bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate has a molecular weight of 489.57 g/mol, XLogP of 5.42, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for bis(9H-fluoren-9-ylmethyl) (2S)-2-aminobutanedioate is sourced from PubChem (CID 11511488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).