C21H24N2O4 — CID 74001834
2,6-diamino-7-(9H-fluoren-9-ylmethoxy)-7-oxoheptanoic acid (PubChem CID 74001834) has the molecular formula C21H24N2O4 and a molecular weight of 368.43 g/mol. Its IUPAC name is 2,6-diamino-7-(9H-fluoren-9-ylmethoxy)-7-oxoheptanoic acid.
| Compound Name | 2,6-diamino-7-(9H-fluoren-9-ylmethoxy)-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 74001834 |
| Molecular Formula | C21H24N2O4 |
| Molecular Weight | 368.43 g/mol |
| Exact Mass | 368.17 |
| IUPAC Name | 2,6-diamino-7-(9H-fluoren-9-ylmethoxy)-7-oxoheptanoic acid |
| SMILES | NC(CCCC(N)C(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C21H24N2O4/c22-18(20(24)25)10-5-11-19(23)21(26)27-12-17-15-8-3-1-6-13(15)14-7-2-4-9-16(14)17/h1-4,6-9,17-19H,5,10-12,22-23H2,(H,24,25) |
| InChIKey | JXGYPHBCPYMHSR-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.43 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |