C22H24O4 — CID 163288654
2-(9H-fluoren-9-ylmethoxycarbonyl)heptanoic acid (PubChem CID 163288654) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is 2-(9H-fluoren-9-ylmethoxycarbonyl)heptanoic acid.
| Compound Name | 2-(9H-fluoren-9-ylmethoxycarbonyl)heptanoic acid |
|---|---|
| PubChem CID | 163288654 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | 2-(9H-fluoren-9-ylmethoxycarbonyl)heptanoic acid |
| SMILES | CCCCCC(C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C22H24O4/c1-2-3-4-13-19(21(23)24)22(25)26-14-20-17-11-7-5-9-15(17)16-10-6-8-12-18(16)20/h5-12,19-20H,2-4,13-14H2,1H3,(H,23,24) |
| InChIKey | OXKHTSWKBLTKSX-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|