C27H35NO4 — CID 97114140
(2S)-12-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)dodecanoic acid (PubChem CID 97114140) has the molecular formula C27H35NO4 and a molecular weight of 437.58 g/mol. Its IUPAC name is (2S)-12-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)dodecanoic acid.
| Compound Name | (2S)-12-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)dodecanoic acid |
|---|---|
| PubChem CID | 97114140 |
| Molecular Formula | C27H35NO4 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.26 |
| IUPAC Name | (2S)-12-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)dodecanoic acid |
| SMILES | NCCCCCCCCCC[C@@H](C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C27H35NO4/c28-18-12-6-4-2-1-3-5-7-17-24(26(29)30)27(31)32-19-25-22-15-10-8-13-20(22)21-14-9-11-16-23(21)25/h8-11,13-16,24-25H,1-7,12,17-19,28H2,(H,29,30)/t24-/m0/s1 |
| InChIKey | QACHIUJZSOWOAX-DEOSSOPVSA-N |
| XLogP | 5.51 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|