C27H33N5O7 — CID 171853524
(2S)-6-amino-2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]hexanoic acid (PubChem CID 171853524) has the molecular formula C27H33N5O7 and a molecular weight of 539.59 g/mol. Its IUPAC name is (2S)-6-amino-2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 171853524 |
| Molecular Formula | C27H33N5O7 |
| Molecular Weight | 539.59 g/mol |
| Exact Mass | 539.24 |
| IUPAC Name | (2S)-6-amino-2-[[2-[[2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]acetyl]amino]acetyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)CNC(=O)CNC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C27H33N5O7/c28-12-6-5-11-22(26(36)37)32-25(35)15-30-23(33)13-29-24(34)14-31-27(38)39-16-21-19-9-3-1-7-17(19)18-8-2-4-10-20(18)21/h1-4,7-10,21-22H,5-6,11-16,28H2,(H,29,34)(H,30,33)(H,31,38)(H,32,35)(H,36,37)/t22-/m0/s1 |
| InChIKey | AXNNXFOXQKCWGH-QFIPXVFZSA-N |
| XLogP | 0.46 |
| TPSA | 188.95 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.59 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|