C29H34N6O6 — CID 175733762
(2S)-6-amino-2-[[(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid (PubChem CID 175733762) has the molecular formula C29H34N6O6 and a molecular weight of 562.63 g/mol. Its IUPAC name is (2S)-6-amino-2-[[(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 175733762 |
| Molecular Formula | C29H34N6O6 |
| Molecular Weight | 562.63 g/mol |
| Exact Mass | 562.25 |
| IUPAC Name | (2S)-6-amino-2-[[(2S)-2-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)acetyl]amino]-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoic acid |
| SMILES | NCCCC[C@H](NC(=O)[C@H](Cc1cnc[nH]1)NC(=O)CNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C29H34N6O6/c30-12-6-5-11-24(28(38)39)35-27(37)25(13-18-14-31-17-33-18)34-26(36)15-32-29(40)41-16-23-21-9-3-1-7-19(21)20-8-2-4-10-22(20)23/h1-4,7-10,14,17,23-25H,5-6,11-13,15-16,30H2,(H,31,33)(H,32,40)(H,34,36)(H,35,37)(H,38,39)/t24-,25-/m0/s1 |
| InChIKey | HWPYTLWCIIONCX-DQEYMECFSA-N |
| XLogP | 1.67 |
| TPSA | 188.53 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.63 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|