C29H38N2O8 — CID 164586477
(2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]hexanoic acid (PubChem CID 164586477) has the molecular formula C29H38N2O8 and a molecular weight of 542.63 g/mol. Its IUPAC name is (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]hexanoic acid.
| Compound Name | (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]hexanoic acid |
|---|---|
| PubChem CID | 164586477 |
| Molecular Formula | C29H38N2O8 |
| Molecular Weight | 542.63 g/mol |
| Exact Mass | 542.26 |
| IUPAC Name | (2S)-6-(9H-fluoren-9-ylmethoxycarbonylamino)-2-[3-[2-(2-methoxyethoxy)ethoxy]propanoylamino]hexanoic acid |
| SMILES | COCCOCCOCCC(=O)N[C@@H](CCCCNC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C29H38N2O8/c1-36-16-17-38-19-18-37-15-13-27(32)31-26(28(33)34)12-6-7-14-30-29(35)39-20-25-23-10-4-2-8-21(23)22-9-3-5-11-24(22)25/h2-5,8-11,25-26H,6-7,12-20H2,1H3,(H,30,35)(H,31,32)(H,33,34)/t26-/m0/s1 |
| InChIKey | AUSWNIWCAISYAP-SANMLTNESA-N |
| XLogP | 3.33 |
| TPSA | 132.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|