C21H24N2O3 — CID 124582995
9H-fluoren-9-ylmethyl N-[(2R)-6-amino-1-oxohexan-2-yl]carbamate (PubChem CID 124582995) has the molecular formula C21H24N2O3 and a molecular weight of 352.43 g/mol. Its IUPAC name is 9H-fluoren-9-ylmethyl N-[(2R)-6-amino-1-oxohexan-2-yl]carbamate.
| Compound Name | 9H-fluoren-9-ylmethyl N-[(2R)-6-amino-1-oxohexan-2-yl]carbamate |
|---|---|
| PubChem CID | 124582995 |
| Molecular Formula | C21H24N2O3 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.18 |
| IUPAC Name | 9H-fluoren-9-ylmethyl N-[(2R)-6-amino-1-oxohexan-2-yl]carbamate |
| SMILES | NCCCC[C@H](C=O)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C21H24N2O3/c22-12-6-5-7-15(13-24)23-21(25)26-14-20-18-10-3-1-8-16(18)17-9-2-4-11-19(17)20/h1-4,8-11,13,15,20H,5-7,12,14,22H2,(H,23,25)/t15-/m1/s1 |
| InChIKey | YWNLUOQGSNHETA-OAHLLOKOSA-N |
| XLogP | 3.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|