C26H32N2O5 — CID 173235018
[(6S)-10-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxodecan-4-yl] formate (PubChem CID 173235018) has the molecular formula C26H32N2O5 and a molecular weight of 452.55 g/mol. Its IUPAC name is [(6S)-10-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxodecan-4-yl] formate.
| Compound Name | [(6S)-10-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxodecan-4-yl] formate |
|---|---|
| PubChem CID | 173235018 |
| Molecular Formula | C26H32N2O5 |
| Molecular Weight | 452.55 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [(6S)-10-amino-6-(9H-fluoren-9-ylmethoxycarbonylamino)-5-oxodecan-4-yl] formate |
| SMILES | CCCC(OC=O)C(=O)[C@H](CCCCN)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C26H32N2O5/c1-2-9-24(33-17-29)25(30)23(14-7-8-15-27)28-26(31)32-16-22-20-12-5-3-10-18(20)19-11-4-6-13-21(19)22/h3-6,10-13,17,22-24H,2,7-9,14-16,27H2,1H3,(H,28,31)/t23-,24?/m0/s1 |
| InChIKey | ZGCNIRQCNCSBKX-UXMRNZNESA-N |
| XLogP | 3.93 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.55 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|