C40H44Cl2N2O5 — CID 157155298
dichloromethane;9H-fluoren-9-ylmethyl N-[(3S)-7-amino-2-oxoheptan-3-yl]carbamate;9H-fluoren-9-ylmethyl propanoate (PubChem CID 157155298) has the molecular formula C40H44Cl2N2O5 and a molecular weight of 703.71 g/mol. Its IUPAC name is dichloromethane;9H-fluoren-9-ylmethyl N-[(3S)-7-amino-2-oxoheptan-3-yl]carbamate;9H-fluoren-9-ylmethyl propanoate.
| Compound Name | dichloromethane;9H-fluoren-9-ylmethyl N-[(3S)-7-amino-2-oxoheptan-3-yl]carbamate;9H-fluoren-9-ylmethyl propanoate |
|---|---|
| PubChem CID | 157155298 |
| Molecular Formula | C40H44Cl2N2O5 |
| Molecular Weight | 703.71 g/mol |
| Exact Mass | 702.26 |
| IUPAC Name | dichloromethane;9H-fluoren-9-ylmethyl N-[(3S)-7-amino-2-oxoheptan-3-yl]carbamate;9H-fluoren-9-ylmethyl propanoate |
| SMILES | CC(=O)[C@H](CCCCN)NC(=O)OCC1c2ccccc2-c2ccccc21.CCC(=O)OCC1c2ccccc2-c2ccccc21.ClCCl |
| InChI | InChI=1S/C22H26N2O3.C17H16O2.CH2Cl2/c1-15(25)21(12-6-7-13-23)24-22(26)27-14-20-18-10-4-2-8-16(18)17-9-3-5-11-19(17)20;1-2-17(18)19-11-16-14-9-5-3-7-12(14)13-8-4-6-10-15(13)16;2-1-3/h2-5,8-11,20-21H,6-7,12-14,23H2,1H3,(H,24,26);3-10,16H,2,11H2,1H3;1H2/t21-;;/m0../s1 |
| InChIKey | ALSTVBFGMLSXCJ-FGJQBABTSA-N |
| XLogP | 8.79 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 703.71 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|