C25H31NO4 — CID 141018797
10-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)decanoic acid (PubChem CID 141018797) has the molecular formula C25H31NO4 and a molecular weight of 409.53 g/mol. Its IUPAC name is 10-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)decanoic acid.
| Compound Name | 10-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)decanoic acid |
|---|---|
| PubChem CID | 141018797 |
| Molecular Formula | C25H31NO4 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.23 |
| IUPAC Name | 10-amino-2-(9H-fluoren-9-ylmethoxycarbonyl)decanoic acid |
| SMILES | NCCCCCCCCC(C(=O)O)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C25H31NO4/c26-16-10-4-2-1-3-5-15-22(24(27)28)25(29)30-17-23-20-13-8-6-11-18(20)19-12-7-9-14-21(19)23/h6-9,11-14,22-23H,1-5,10,15-17,26H2,(H,27,28) |
| InChIKey | MLMTWNHGUDJOBS-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|