C20H22N2O3 — CID 154512330
(2S)-2,6-diamino-7-(9H-fluoren-9-yl)-7-oxoheptanoic acid (PubChem CID 154512330) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2S)-2,6-diamino-7-(9H-fluoren-9-yl)-7-oxoheptanoic acid.
| Compound Name | (2S)-2,6-diamino-7-(9H-fluoren-9-yl)-7-oxoheptanoic acid |
|---|---|
| PubChem CID | 154512330 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (2S)-2,6-diamino-7-(9H-fluoren-9-yl)-7-oxoheptanoic acid |
| SMILES | NC(CCC[C@H](N)C(=O)O)C(=O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C20H22N2O3/c21-16(10-5-11-17(22)20(24)25)19(23)18-14-8-3-1-6-12(14)13-7-2-4-9-15(13)18/h1-4,6-9,16-18H,5,10-11,21-22H2,(H,24,25)/t16?,17-/m0/s1 |
| InChIKey | MUYSEVOYCFYPCC-DJNXLDHESA-N |
| XLogP | 2.28 |
| TPSA | 106.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |