C19H21NO4S — CID 175237990
2-amino-4-methylsulfanylbutanoic acid;9H-fluorene-9-carboxylic acid (PubChem CID 175237990) has the molecular formula C19H21NO4S and a molecular weight of 359.45 g/mol. Its IUPAC name is 2-amino-4-methylsulfanylbutanoic acid;9H-fluorene-9-carboxylic acid.
| Compound Name | 2-amino-4-methylsulfanylbutanoic acid;9H-fluorene-9-carboxylic acid |
|---|---|
| PubChem CID | 175237990 |
| Molecular Formula | C19H21NO4S |
| Molecular Weight | 359.45 g/mol |
| Exact Mass | 359.12 |
| IUPAC Name | 2-amino-4-methylsulfanylbutanoic acid;9H-fluorene-9-carboxylic acid |
| SMILES | CSCCC(N)C(=O)O.O=C(O)C1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C14H10O2.C5H11NO2S/c15-14(16)13-11-7-3-1-5-9(11)10-6-2-4-8-12(10)13;1-9-3-2-4(6)5(7)8/h1-8,13H,(H,15,16);4H,2-3,6H2,1H3,(H,7,8) |
| InChIKey | SXJOHTWEKLEAHU-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.45 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |