C18H17NO4 — CID 14559129
2-amino-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid (PubChem CID 14559129) has the molecular formula C18H17NO4 and a molecular weight of 311.34 g/mol. Its IUPAC name is 2-amino-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid.
| Compound Name | 2-amino-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 14559129 |
| Molecular Formula | C18H17NO4 |
| Molecular Weight | 311.34 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 2-amino-4-(9H-fluoren-9-ylmethoxy)-4-oxobutanoic acid |
| SMILES | NC(CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C18H17NO4/c19-16(18(21)22)9-17(20)23-10-15-13-7-3-1-5-11(13)12-6-2-4-8-14(12)15/h1-8,15-16H,9-10,19H2,(H,21,22) |
| InChIKey | FDNQJSUPJXCUFZ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 89.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.34 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |