C22H24O4 — CID 149470928
(2S)-2-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]-3-methylpentanoic acid (PubChem CID 149470928) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is (2S)-2-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]-3-methylpentanoic acid.
| Compound Name | (2S)-2-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 149470928 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | (2S)-2-[2-(9H-fluoren-9-ylmethoxy)-2-oxoethyl]-3-methylpentanoic acid |
| SMILES | CCC(C)C(CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)O |
| InChI | InChI=1S/C22H24O4/c1-3-14(2)19(22(24)25)12-21(23)26-13-20-17-10-6-4-8-15(17)16-9-5-7-11-18(16)20/h4-11,14,19-20H,3,12-13H2,1-2H3,(H,24,25) |
| InChIKey | ZBIOJRCUJSLFAJ-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |