C27H21F5O4 — CID 167704359
4-O-(9H-fluoren-9-ylmethyl) 1-O-(2,3,4,5,6-pentafluorophenyl) (2S)-2-propan-2-ylbutanedioate (PubChem CID 167704359) has the molecular formula C27H21F5O4 and a molecular weight of 504.45 g/mol. Its IUPAC name is 4-O-(9H-fluoren-9-ylmethyl) 1-O-(2,3,4,5,6-pentafluorophenyl) (2S)-2-propan-2-ylbutanedioate.
| Compound Name | 4-O-(9H-fluoren-9-ylmethyl) 1-O-(2,3,4,5,6-pentafluorophenyl) (2S)-2-propan-2-ylbutanedioate |
|---|---|
| PubChem CID | 167704359 |
| Molecular Formula | C27H21F5O4 |
| Molecular Weight | 504.45 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 4-O-(9H-fluoren-9-ylmethyl) 1-O-(2,3,4,5,6-pentafluorophenyl) (2S)-2-propan-2-ylbutanedioate |
| SMILES | CC(C)[C@H](CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C27H21F5O4/c1-13(2)18(27(34)36-26-24(31)22(29)21(28)23(30)25(26)32)11-20(33)35-12-19-16-9-5-3-7-14(16)15-8-4-6-10-17(15)19/h3-10,13,18-19H,11-12H2,1-2H3/t18-/m0/s1 |
| InChIKey | ZDMFATBDRXZENX-SFHVURJKSA-N |
| XLogP | 6.31 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.45 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|