C42H39ClO4 — CID 164960010
1-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 4-O-(9H-fluoren-9-ylmethyl) (2S)-2-[(2S)-butan-2-yl]butanedioate (PubChem CID 164960010) has the molecular formula C42H39ClO4 and a molecular weight of 643.22 g/mol. Its IUPAC name is 1-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 4-O-(9H-fluoren-9-ylmethyl) (2S)-2-[(2S)-butan-2-yl]butanedioate.
| Compound Name | 1-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 4-O-(9H-fluoren-9-ylmethyl) (2S)-2-[(2S)-butan-2-yl]butanedioate |
|---|---|
| PubChem CID | 164960010 |
| Molecular Formula | C42H39ClO4 |
| Molecular Weight | 643.22 g/mol |
| Exact Mass | 642.25 |
| IUPAC Name | 1-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] 4-O-(9H-fluoren-9-ylmethyl) (2S)-2-[(2S)-butan-2-yl]butanedioate |
| SMILES | CC[C@H](C)[C@H](CC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC(c1ccccc1)(c1ccc(C)cc1)c1ccccc1Cl |
| InChI | InChI=1S/C42H39ClO4/c1-4-29(3)36(26-40(44)46-27-37-34-18-10-8-16-32(34)33-17-9-11-19-35(33)37)41(45)47-42(30-14-6-5-7-15-30,31-24-22-28(2)23-25-31)38-20-12-13-21-39(38)43/h5-25,29,36-37H,4,26-27H2,1-3H3/t29-,36-,42?/m0/s1 |
| InChIKey | BSCVITOTZCEGBU-CWDNOTGFSA-N |
| XLogP | 9.89 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 643.22 |
| LogP ≤ 5 | 9.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|