C44H42ClNO6 — CID 176765633
1-O-tert-butyl 5-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate (PubChem CID 176765633) has the molecular formula C44H42ClNO6 and a molecular weight of 716.27 g/mol. Its IUPAC name is 1-O-tert-butyl 5-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate.
| Compound Name | 1-O-tert-butyl 5-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate |
|---|---|
| PubChem CID | 176765633 |
| Molecular Formula | C44H42ClNO6 |
| Molecular Weight | 716.27 g/mol |
| Exact Mass | 715.27 |
| IUPAC Name | 1-O-tert-butyl 5-O-[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)pentanedioate |
| SMILES | Cc1ccc(C(OC(=O)CC[C@@H](NC(=O)OCC2c3ccccc3-c3ccccc32)C(=O)OC(C)(C)C)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C44H42ClNO6/c1-29-22-24-31(25-23-29)44(30-14-6-5-7-15-30,37-20-12-13-21-38(37)45)51-40(47)27-26-39(41(48)52-43(2,3)4)46-42(49)50-28-36-34-18-10-8-16-32(34)33-17-9-11-19-35(33)36/h5-25,36,39H,26-28H2,1-4H3,(H,46,49)/t39-,44?/m1/s1 |
| InChIKey | GGZBDGXTVDRZEN-AEVARHPNSA-N |
| XLogP | 9.51 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 716.27 |
| LogP ≤ 5 | 9.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|