C42H37ClN2O5 — CID 170341958
[(2-chlorophenyl)-diphenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-pyrrolidin-1-ylbutanoate (PubChem CID 170341958) has the molecular formula C42H37ClN2O5 and a molecular weight of 685.22 g/mol. Its IUPAC name is [(2-chlorophenyl)-diphenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-pyrrolidin-1-ylbutanoate.
| Compound Name | [(2-chlorophenyl)-diphenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-pyrrolidin-1-ylbutanoate |
|---|---|
| PubChem CID | 170341958 |
| Molecular Formula | C42H37ClN2O5 |
| Molecular Weight | 685.22 g/mol |
| Exact Mass | 684.24 |
| IUPAC Name | [(2-chlorophenyl)-diphenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-oxo-4-pyrrolidin-1-ylbutanoate |
| SMILES | O=C(C[C@H](NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)N1CCCC1)OC(c1ccccc1)(c1ccccc1)c1ccccc1Cl |
| InChI | InChI=1S/C42H37ClN2O5/c43-37-24-12-11-23-36(37)42(29-15-3-1-4-16-29,30-17-5-2-6-18-30)50-39(46)27-38(40(47)45-25-13-14-26-45)44-41(48)49-28-35-33-21-9-7-19-31(33)32-20-8-10-22-34(32)35/h1-12,15-24,35,38H,13-14,25-28H2,(H,44,48)/t38-/m0/s1 |
| InChIKey | RQYZSUQJMHGCTL-LHEWISCISA-N |
| XLogP | 8.09 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 685.22 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|