C54H57ClN2O7 — CID 167030765
[(2-chlorophenyl)-(4-cyclononylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[methyl-(3-oxo-3-prop-2-enoxypropyl)amino]-4-oxobutanoate (PubChem CID 167030765) has the molecular formula C54H57ClN2O7 and a molecular weight of 881.51 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-cyclononylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[methyl-(3-oxo-3-prop-2-enoxypropyl)amino]-4-oxobutanoate.
| Compound Name | [(2-chlorophenyl)-(4-cyclononylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[methyl-(3-oxo-3-prop-2-enoxypropyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 167030765 |
| Molecular Formula | C54H57ClN2O7 |
| Molecular Weight | 881.51 g/mol |
| Exact Mass | 880.39 |
| IUPAC Name | [(2-chlorophenyl)-(4-cyclononylphenyl)-phenylmethyl] (3S)-3-(9H-fluoren-9-ylmethoxycarbonylamino)-4-[methyl-(3-oxo-3-prop-2-enoxypropyl)amino]-4-oxobutanoate |
| SMILES | C=CCOC(=O)CCN(C)C(=O)[C@H](CC(=O)OC(c1ccccc1)(c1ccc(C2CCCCCCCC2)cc1)c1ccccc1Cl)NC(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C54H57ClN2O7/c1-3-35-62-50(58)33-34-57(2)52(60)49(56-53(61)63-37-46-44-25-15-13-23-42(44)43-24-14-16-26-45(43)46)36-51(59)64-54(40-21-11-8-12-22-40,47-27-17-18-28-48(47)55)41-31-29-39(30-32-41)38-19-9-6-4-5-7-10-20-38/h3,8,11-18,21-32,38,46,49H,1,4-7,9-10,19-20,33-37H2,2H3,(H,56,61)/t49-,54?/m0/s1 |
| InChIKey | HFPXGTRBHWAGLC-GORDMYRASA-N |
| XLogP | 11.27 |
| TPSA | 111.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 881.51 |
| LogP ≤ 5 | 11.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|