C47H48ClNO4 — CID 167140772
[(2-chlorophenyl)-(4-cyclooctylphenyl)-phenylmethyl] (3R)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoate (PubChem CID 167140772) has the molecular formula C47H48ClNO4 and a molecular weight of 726.36 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-cyclooctylphenyl)-phenylmethyl] (3R)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoate.
| Compound Name | [(2-chlorophenyl)-(4-cyclooctylphenyl)-phenylmethyl] (3R)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoate |
|---|---|
| PubChem CID | 167140772 |
| Molecular Formula | C47H48ClNO4 |
| Molecular Weight | 726.36 g/mol |
| Exact Mass | 725.33 |
| IUPAC Name | [(2-chlorophenyl)-(4-cyclooctylphenyl)-phenylmethyl] (3R)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]butanoate |
| SMILES | C[C@H](CC(=O)OC(c1ccccc1)(c1ccc(C2CCCCCCC2)cc1)c1ccccc1Cl)N(C)C(=O)OCC1c2ccccc2-c2ccccc21 |
| InChI | InChI=1S/C47H48ClNO4/c1-33(49(2)46(51)52-32-42-40-23-13-11-21-38(40)39-22-12-14-24-41(39)42)31-45(50)53-47(36-19-9-6-10-20-36,43-25-15-16-26-44(43)48)37-29-27-35(28-30-37)34-17-7-4-3-5-8-18-34/h6,9-16,19-30,33-34,42H,3-5,7-8,17-18,31-32H2,1-2H3/t33-,47?/m1/s1 |
| InChIKey | BHKFUDZFYYJFRT-BIMDHKGKSA-N |
| XLogP | 11.66 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.36 |
| LogP ≤ 5 | 11.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|