C44H37ClF4N2O5 — CID 168737541
[(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butanoate (PubChem CID 168737541) has the molecular formula C44H37ClF4N2O5 and a molecular weight of 785.23 g/mol. Its IUPAC name is [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butanoate.
| Compound Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butanoate |
|---|---|
| PubChem CID | 168737541 |
| Molecular Formula | C44H37ClF4N2O5 |
| Molecular Weight | 785.23 g/mol |
| Exact Mass | 784.23 |
| IUPAC Name | [(2-chlorophenyl)-(4-methylphenyl)-phenylmethyl] (3S)-3-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-4-oxo-4-(3,3,4,4-tetrafluoropyrrolidin-1-yl)butanoate |
| SMILES | Cc1ccc(C(OC(=O)C[C@@H](C(=O)N2CC(F)(F)C(F)(F)C2)N(C)C(=O)OCC2c3ccccc3-c3ccccc32)(c2ccccc2)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C44H37ClF4N2O5/c1-28-20-22-30(23-21-28)44(29-12-4-3-5-13-29,36-18-10-11-19-37(36)45)56-39(52)24-38(40(53)51-26-42(46,47)43(48,49)27-51)50(2)41(54)55-25-35-33-16-8-6-14-31(33)32-15-7-9-17-34(32)35/h3-23,35,38H,24-27H2,1-2H3/t38-,44?/m0/s1 |
| InChIKey | KMEVGOMBVSGJAV-VBIMAARKSA-N |
| XLogP | 9.24 |
| TPSA | 76.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.23 |
| LogP ≤ 5 | 9.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|